C13H8Br3N2O6S- — CID 4556494
5-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 4556494) has the molecular formula C13H8Br3N2O6S- and a molecular weight of 559.99 g/mol. Its IUPAC name is 5-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | 5-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 4556494 |
| Molecular Formula | C13H8Br3N2O6S- |
| Molecular Weight | 559.99 g/mol |
| Exact Mass | 556.77 |
| IUPAC Name | 5-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NN=Cc1ccc(S(=O)(=O)[O-])o1 |
| InChI | InChI=1S/C13H9Br3N2O6S/c14-7-3-9(15)13(10(16)4-7)23-6-11(19)18-17-5-8-1-2-12(24-8)25(20,21)22/h1-5H,6H2,(H,18,19)(H,20,21,22)/p-1 |
| InChIKey | ZAZAKHPOQSEVFP-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|