C15H8Br6N2O3 — CID 44615960
N-[(E)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 44615960) has the molecular formula C15H8Br6N2O3 and a molecular weight of 743.66 g/mol. Its IUPAC name is N-[(E)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 44615960 |
| Molecular Formula | C15H8Br6N2O3 |
| Molecular Weight | 743.66 g/mol |
| Exact Mass | 737.56 |
| IUPAC Name | N-[(E)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C/c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C15H8Br6N2O3/c16-6-1-10(19)15(11(20)2-6)26-5-12(24)23-22-4-7-8(17)3-9(18)14(25)13(7)21/h1-4,25H,5H2,(H,23,24)/b22-4+ |
| InChIKey | QEPUMIIWTCBCEV-LKNXVUQUSA-N |
| XLogP | 6.50 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|