C16H12Br2I2N2O3 — CID 136815939
2-(2,6-dibromo-4-methylphenoxy)-N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 136815939) has the molecular formula C16H12Br2I2N2O3 and a molecular weight of 693.90 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylphenoxy)-N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136815939 |
| Molecular Formula | C16H12Br2I2N2O3 |
| Molecular Weight | 693.90 g/mol |
| Exact Mass | 691.73 |
| IUPAC Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(Br)c(OCC(=O)N/N=C\c2cc(I)c(O)c(I)c2)c(Br)c1 |
| InChI | InChI=1S/C16H12Br2I2N2O3/c1-8-2-10(17)16(11(18)3-8)25-7-14(23)22-21-6-9-4-12(19)15(24)13(20)5-9/h2-6,24H,7H2,1H3,(H,22,23)/b21-6- |
| InChIKey | QGVMJJFUSKHOTD-MPUCSWFWSA-N |
| XLogP | 4.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|