C17H16BrIN2O3 — CID 3928116
2-(2-bromo-4,6-dimethylphenoxy)-N-[(4-hydroxy-3-iodophenyl)methylideneamino]acetamide (PubChem CID 3928116) has the molecular formula C17H16BrIN2O3 and a molecular weight of 503.13 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)-N-[(4-hydroxy-3-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(4-hydroxy-3-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3928116 |
| Molecular Formula | C17H16BrIN2O3 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(4-hydroxy-3-iodophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NN=Cc2ccc(O)c(I)c2)c(Br)c1 |
| InChI | InChI=1S/C17H16BrIN2O3/c1-10-5-11(2)17(13(18)6-10)24-9-16(23)21-20-8-12-3-4-15(22)14(19)7-12/h3-8,22H,9H2,1-2H3,(H,21,23) |
| InChIKey | OYRFQDMUDYHAEP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|