C15H14BrClN2O2S — CID 5434198
2-(2-bromo-4,6-dimethylphenoxy)-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]acetamide (PubChem CID 5434198) has the molecular formula C15H14BrClN2O2S and a molecular weight of 401.71 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5434198 |
| Molecular Formula | C15H14BrClN2O2S |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)N/N=C\c2ccc(Cl)s2)c(Br)c1 |
| InChI | InChI=1S/C15H14BrClN2O2S/c1-9-5-10(2)15(12(16)6-9)21-8-14(20)19-18-7-11-3-4-13(17)22-11/h3-7H,8H2,1-2H3,(H,19,20)/b18-7- |
| InChIKey | KSFGOVLFPZKLQC-WSVATBPTSA-N |
| XLogP | 4.31 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|