C18H16Br2N2O4 — CID 38052163
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-bromo-4,6-dimethylphenoxy)acetamide (PubChem CID 38052163) has the molecular formula C18H16Br2N2O4 and a molecular weight of 484.14 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-bromo-4,6-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-bromo-4,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 38052163 |
| Molecular Formula | C18H16Br2N2O4 |
| Molecular Weight | 484.14 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-bromo-4,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)N/N=C/c2cc3c(cc2Br)OCO3)c(Br)c1 |
| InChI | InChI=1S/C18H16Br2N2O4/c1-10-3-11(2)18(14(20)4-10)24-8-17(23)22-21-7-12-5-15-16(6-13(12)19)26-9-25-15/h3-7H,8-9H2,1-2H3,(H,22,23)/b21-7+ |
| InChIKey | WSPMQAKHLLFOOR-QPSGOUHRSA-N |
| XLogP | 4.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|