C18H17BrN2O5 — CID 39876586
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 39876586) has the molecular formula C18H17BrN2O5 and a molecular weight of 421.25 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39876586 |
| Molecular Formula | C18H17BrN2O5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc3c(cc2Br)OCO3)cc1OC |
| InChI | InChI=1S/C18H17BrN2O5/c1-23-14-4-3-11(5-15(14)24-2)6-18(22)21-20-9-12-7-16-17(8-13(12)19)26-10-25-16/h3-5,7-9H,6,10H2,1-2H3,(H,21,22)/b20-9+ |
| InChIKey | BWQDONXTLUOWHR-AWQFTUOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|