C16H13BrN2O5 — CID 135627870
2-(1,3-benzodioxol-5-yl)-N-[(E)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 135627870) has the molecular formula C16H13BrN2O5 and a molecular weight of 393.19 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(E)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(E)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135627870 |
| Molecular Formula | C16H13BrN2O5 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(E)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C/c1cc(Br)c(O)cc1O |
| InChI | InChI=1S/C16H13BrN2O5/c17-11-5-10(12(20)6-13(11)21)7-18-19-16(22)4-9-1-2-14-15(3-9)24-8-23-14/h1-3,5-7,20-21H,4,8H2,(H,19,22)/b18-7+ |
| InChIKey | KGESTPAMZXLATR-CNHKJKLMSA-N |
| XLogP | 2.28 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|