C22H20Br2N4O6 — CID 6162466
N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]hexanediamide (PubChem CID 6162466) has the molecular formula C22H20Br2N4O6 and a molecular weight of 596.23 g/mol. Its IUPAC name is N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 6162466 |
| Molecular Formula | C22H20Br2N4O6 |
| Molecular Weight | 596.23 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | N,N'-bis[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]hexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C\c1cc2c(cc1Br)OCO2)N/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C22H20Br2N4O6/c23-15-7-19-17(31-11-33-19)5-13(15)9-25-27-21(29)3-1-2-4-22(30)28-26-10-14-6-18-20(8-16(14)24)34-12-32-18/h5-10H,1-4,11-12H2,(H,27,29)(H,28,30)/b25-9-,26-10- |
| InChIKey | KUOAELBPMZVUBG-UMOSFCNPSA-N |
| XLogP | 3.83 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|