C21H18N6O10 — CID 4151242
N,N'-bis[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide (PubChem CID 4151242) has the molecular formula C21H18N6O10 and a molecular weight of 514.41 g/mol. Its IUPAC name is N,N'-bis[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide.
| Compound Name | N,N'-bis[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 4151242 |
| Molecular Formula | C21H18N6O10 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | N,N'-bis[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2)NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C21H18N6O10/c28-20(24-22-8-12-4-16-18(36-10-34-16)6-14(12)26(30)31)2-1-3-21(29)25-23-9-13-5-17-19(37-11-35-17)7-15(13)27(32)33/h4-9H,1-3,10-11H2,(H,24,28)(H,25,29) |
| InChIKey | LASUBZAFUKQHIT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 206.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|