C15H10IN3O5 — CID 6868984
3-iodo-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide (PubChem CID 6868984) has the molecular formula C15H10IN3O5 and a molecular weight of 439.17 g/mol. Its IUPAC name is 3-iodo-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide.
| Compound Name | 3-iodo-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6868984 |
| Molecular Formula | C15H10IN3O5 |
| Molecular Weight | 439.17 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 3-iodo-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2)c1cccc(I)c1 |
| InChI | InChI=1S/C15H10IN3O5/c16-11-3-1-2-9(4-11)15(20)18-17-7-10-5-13-14(24-8-23-13)6-12(10)19(21)22/h1-7H,8H2,(H,18,20)/b17-7+ |
| InChIKey | IJJXXOLSNRXGFH-REZTVBANSA-N |
| XLogP | 2.69 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|