C15H9Cl2N3O5 — CID 6140040
3,4-dichloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide (PubChem CID 6140040) has the molecular formula C15H9Cl2N3O5 and a molecular weight of 382.16 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6140040 |
| Molecular Formula | C15H9Cl2N3O5 |
| Molecular Weight | 382.16 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2N3O5/c16-10-2-1-8(3-11(10)17)15(21)19-18-6-9-4-13-14(25-7-24-13)5-12(9)20(22)23/h1-6H,7H2,(H,19,21)/b18-6- |
| InChIKey | SNFBPWREAAEPDJ-FXBPXSCXSA-N |
| XLogP | 3.39 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|