C18H17N3O8 — CID 2592613
3,4,5-trimethoxy-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide (PubChem CID 2592613) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2592613 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| SMILES | COc1cc(C(=O)NN=Cc2cc3c(cc2[N+](=O)[O-])OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C18H17N3O8/c1-25-15-4-10(5-16(26-2)17(15)27-3)18(22)20-19-8-11-6-13-14(29-9-28-13)7-12(11)21(23)24/h4-8H,9H2,1-3H3,(H,20,22) |
| InChIKey | NBQUIPCEZVBTEU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|