C18H17N3O7 — CID 3944141
2-(2-ethoxyphenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 3944141) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3944141 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C18H17N3O7/c1-2-25-14-5-3-4-6-15(14)26-10-18(22)20-19-9-12-7-16-17(28-11-27-16)8-13(12)21(23)24/h3-9H,2,10-11H2,1H3,(H,20,22) |
| InChIKey | XXMCGPDIMQPHOI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|