C16H12N4O8 — CID 19165657
N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide (PubChem CID 19165657) has the molecular formula C16H12N4O8 and a molecular weight of 388.29 g/mol. Its IUPAC name is N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 19165657 |
| Molecular Formula | C16H12N4O8 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C16H12N4O8/c21-16(8-26-12-3-1-11(2-4-12)19(22)23)18-17-7-10-5-14-15(28-9-27-14)6-13(10)20(24)25/h1-7H,8-9H2,(H,18,21)/b17-7+ |
| InChIKey | RZHXHORZISRDSX-REZTVBANSA-N |
| XLogP | 1.76 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|