C16H11BrClN3O6 — CID 1165409
2-(2-bromo-4-nitrophenoxy)-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 1165409) has the molecular formula C16H11BrClN3O6 and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenoxy)-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenoxy)-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1165409 |
| Molecular Formula | C16H11BrClN3O6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 454.95 |
| IUPAC Name | 2-(2-bromo-4-nitrophenoxy)-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Br)NN=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C16H11BrClN3O6/c17-11-4-10(21(23)24)1-2-13(11)25-7-16(22)20-19-6-9-3-14-15(5-12(9)18)27-8-26-14/h1-6H,7-8H2,(H,20,22) |
| InChIKey | APOQRHFQYPARKG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|