C19H21BrN4O4 — CID 1165506
2-(2-bromo-4-nitrophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide (PubChem CID 1165506) has the molecular formula C19H21BrN4O4 and a molecular weight of 449.31 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 1165506 |
| Molecular Formula | C19H21BrN4O4 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-(2-bromo-4-nitrophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)COc2ccc([N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C19H21BrN4O4/c1-3-23(4-2)15-7-5-14(6-8-15)12-21-22-19(25)13-28-18-10-9-16(24(26)27)11-17(18)20/h5-12H,3-4,13H2,1-2H3,(H,22,25) |
| InChIKey | WEXPJYFUQCRYQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|