C22H18BrN3O7S — CID 19577649
[4-[(E)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate (PubChem CID 19577649) has the molecular formula C22H18BrN3O7S and a molecular weight of 548.37 g/mol. Its IUPAC name is [4-[(E)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19577649 |
| Molecular Formula | C22H18BrN3O7S |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | [4-[(E)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2Br)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H18BrN3O7S/c1-2-31-19-10-14(5-7-18(19)33-22(28)20-4-3-9-34-20)12-24-25-21(27)13-32-17-8-6-15(26(29)30)11-16(17)23/h3-12H,2,13H2,1H3,(H,25,27)/b24-12+ |
| InChIKey | BPTRXTVYWPBIMM-WYMPLXKRSA-N |
| XLogP | 4.57 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|