C21H17FN2O5S — CID 29226515
[4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 29226515) has the molecular formula C21H17FN2O5S and a molecular weight of 428.44 g/mol. Its IUPAC name is [4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 29226515 |
| Molecular Formula | C21H17FN2O5S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccccc2F)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C21H17FN2O5S/c1-27-18-11-14(8-9-17(18)29-21(26)19-7-4-10-30-19)12-23-24-20(25)13-28-16-6-3-2-5-15(16)22/h2-12H,13H2,1H3,(H,24,25)/b23-12- |
| InChIKey | YIKJZOUVPKCPRB-FMCGGJTJSA-N |
| XLogP | 3.64 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|