C19H15ClN2O3S — CID 4071747
[4-[[(4-chlorophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 4071747) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[(4-chlorophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4071747 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [4-[[(4-chlorophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNc2ccc(Cl)cc2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C19H15ClN2O3S/c1-24-17-11-13(12-21-22-15-7-5-14(20)6-8-15)4-9-16(17)25-19(23)18-3-2-10-26-18/h2-12,22H,1H3 |
| InChIKey | SFMHSRHBTCVCSJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|