C24H18N2O5S — CID 3128061
[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 3128061) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3128061 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2cc3ccccc3cc2O)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C24H18N2O5S/c1-30-21-11-15(8-9-20(21)31-24(29)22-7-4-10-32-22)14-25-26-23(28)18-12-16-5-2-3-6-17(16)13-19(18)27/h2-14,27H,1H3,(H,26,28) |
| InChIKey | IRUMVOJBGYQWIT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|