C25H20N2O5S — CID 3128062
[2-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 3128062) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3128062 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(C=NNC(=O)c2cc3ccccc3cc2O)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C25H20N2O5S/c1-2-31-22-12-16(9-10-21(22)32-25(30)23-8-5-11-33-23)15-26-27-24(29)19-13-17-6-3-4-7-18(17)14-20(19)28/h3-15,28H,2H2,1H3,(H,27,29) |
| InChIKey | ZUVIYDZHCMMRGH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|