C30H27N3O5S — CID 6065644
[4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate (PubChem CID 6065644) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6065644 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(/C=N\NC(=O)CNC(=O)C(c2ccccc2)c2ccccc2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C30H27N3O5S/c1-2-37-25-18-21(15-16-24(25)38-30(36)26-14-9-17-39-26)19-32-33-27(34)20-31-29(35)28(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-19,28H,2,20H2,1H3,(H,31,35)(H,33,34)/b32-19- |
| InChIKey | YOSGHSGHFGTTPU-MZFJOGFUSA-N |
| XLogP | 4.76 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|