C28H23N3O5S2 — CID 5097372
[4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate (PubChem CID 5097372) has the molecular formula C28H23N3O5S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5097372 |
| Molecular Formula | C28H23N3O5S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(C=NNC(=O)C(=Cc2cccs2)NC(=O)c2ccccc2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C28H23N3O5S2/c1-2-35-24-16-19(12-13-23(24)36-28(34)25-11-7-15-38-25)18-29-31-27(33)22(17-21-10-6-14-37-21)30-26(32)20-8-4-3-5-9-20/h3-18H,2H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | ITUHMDLMXIQDBF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|