C28H23N3O6S — CID 3969826
[4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 3969826) has the molecular formula C28H23N3O6S and a molecular weight of 529.57 g/mol. Its IUPAC name is [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3969826 |
| Molecular Formula | C28H23N3O6S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | [4-[[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(C=NNC(=O)C(=Cc2cccs2)NC(=O)c2ccccc2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C28H23N3O6S/c1-2-35-25-16-19(12-13-23(25)37-28(34)24-11-6-14-36-24)18-29-31-27(33)22(17-21-10-7-15-38-21)30-26(32)20-8-4-3-5-9-20/h3-18H,2H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | GGIBSFXRQZIOKZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|