C28H21N3O5S — CID 129439357
[4-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate (PubChem CID 129439357) has the molecular formula C28H21N3O5S and a molecular weight of 511.56 g/mol. Its IUPAC name is [4-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 129439357 |
| Molecular Formula | C28H21N3O5S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | [4-[[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C\c1ccco1)Oc1ccc(C=NNC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N3O5S/c32-26(15-14-22-8-4-16-35-22)36-23-12-10-20(11-13-23)19-29-31-28(34)25(18-24-9-5-17-37-24)30-27(33)21-6-2-1-3-7-21/h1-19H,(H,30,33)(H,31,34)/b15-14-,25-18-,29-19? |
| InChIKey | LRYJMHKNAKUVLE-UVROHOHVSA-N |
| XLogP | 4.88 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|