C21H16BrN3O2S — CID 56688798
N-[(E)-3-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 56688798) has the molecular formula C21H16BrN3O2S and a molecular weight of 454.35 g/mol. Its IUPAC name is N-[(E)-3-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 56688798 |
| Molecular Formula | C21H16BrN3O2S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-[(E)-3-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C/c1cccc(Br)c1)/C(=C\c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16BrN3O2S/c22-17-9-4-6-15(12-17)14-23-25-21(27)19(13-18-10-5-11-28-18)24-20(26)16-7-2-1-3-8-16/h1-14H,(H,24,26)(H,25,27)/b19-13+,23-14+ |
| InChIKey | LJBQPLKTBZSGOH-KAVVDJPUSA-N |
| XLogP | 4.43 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|