C21H15Cl2N3O2S — CID 124865303
N-[(E)-3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 124865303) has the molecular formula C21H15Cl2N3O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[(E)-3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124865303 |
| Molecular Formula | C21H15Cl2N3O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | N-[(E)-3-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1Cl)/C(=C\c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15Cl2N3O2S/c22-16-9-8-15(18(23)11-16)13-24-26-21(28)19(12-17-7-4-10-29-17)25-20(27)14-5-2-1-3-6-14/h1-13H,(H,25,27)(H,26,28)/b19-12+,24-13? |
| InChIKey | FLOGWQKFERMLIW-SAMODZKWSA-N |
| XLogP | 4.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|