C30H24N6O4S2 — CID 3093250
N-[3-[2-[2-[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]ethylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 3093250) has the molecular formula C30H24N6O4S2 and a molecular weight of 596.69 g/mol. Its IUPAC name is N-[3-[2-[2-[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]ethylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[2-[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]ethylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3093250 |
| Molecular Formula | C30H24N6O4S2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | N-[3-[2-[2-[(2-benzamido-3-thiophen-2-ylprop-2-enoyl)hydrazinylidene]ethylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=CC=NNC(=O)C(=Cc1cccs1)NC(=O)c1ccccc1)C(=Cc1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H24N6O4S2/c37-27(21-9-3-1-4-10-21)33-25(19-23-13-7-17-41-23)29(39)35-31-15-16-32-36-30(40)26(20-24-14-8-18-42-24)34-28(38)22-11-5-2-6-12-22/h1-20H,(H,33,37)(H,34,38)(H,35,39)(H,36,40) |
| InChIKey | ZIJIWUPMPSXNJL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|