C21H16IN3O3S — CID 136691641
N-[3-[2-[(4-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 136691641) has the molecular formula C21H16IN3O3S and a molecular weight of 517.35 g/mol. Its IUPAC name is N-[3-[2-[(4-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(4-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 136691641 |
| Molecular Formula | C21H16IN3O3S |
| Molecular Weight | 517.35 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | N-[3-[2-[(4-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(O)c(I)c1)C(=Cc1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16IN3O3S/c22-17-11-14(8-9-19(17)26)13-23-25-21(28)18(12-16-7-4-10-29-16)24-20(27)15-5-2-1-3-6-15/h1-13,26H,(H,24,27)(H,25,28) |
| InChIKey | HNHFFYKNJAOONH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|