C27H30N4O2S — CID 6385489
N-[(E)-3-[(2Z)-2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 6385489) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is N-[(E)-3-[(2Z)-2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[(2Z)-2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6385489 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[(E)-3-[(2Z)-2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCCN(CCC)c1ccc(/C=N\NC(=O)/C(=C\c2cccs2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N4O2S/c1-3-16-31(17-4-2)23-14-12-21(13-15-23)20-28-30-27(33)25(19-24-11-8-18-34-24)29-26(32)22-9-6-5-7-10-22/h5-15,18-20H,3-4,16-17H2,1-2H3,(H,29,32)(H,30,33)/b25-19+,28-20- |
| InChIKey | DZBFYOOCDYXUNP-UOKWSTPLSA-N |
| XLogP | 5.30 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|