C27H23N3O3S — CID 46502300
N-[(Z)-3-[(2E)-2-[(2-ethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 46502300) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[(Z)-3-[(2E)-2-[(2-ethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2E)-2-[(2-ethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46502300 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[(Z)-3-[(2E)-2-[(2-ethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc2ccccc2c1/C=N/NC(=O)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O3S/c1-2-33-25-15-14-19-9-6-7-13-22(19)23(25)18-28-30-27(32)24(17-21-12-8-16-34-21)29-26(31)20-10-4-3-5-11-20/h3-18H,2H2,1H3,(H,29,31)(H,30,32)/b24-17-,28-18+ |
| InChIKey | SEVDSDKYFIYVMQ-WTIJGKOKSA-N |
| XLogP | 5.22 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|