C31H26N4O2S — CID 129437766
N-[(E)-3-[2-[(1-benzyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 129437766) has the molecular formula C31H26N4O2S and a molecular weight of 518.64 g/mol. Its IUPAC name is N-[(E)-3-[2-[(1-benzyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[2-[(1-benzyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 129437766 |
| Molecular Formula | C31H26N4O2S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[(E)-3-[2-[(1-benzyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1c(C=NNC(=O)/C(=C\c2cccs2)NC(=O)c2ccccc2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C31H26N4O2S/c1-22-27(26-16-8-9-17-29(26)35(22)21-23-11-4-2-5-12-23)20-32-34-31(37)28(19-25-15-10-18-38-25)33-30(36)24-13-6-3-7-14-24/h2-20H,21H2,1H3,(H,33,36)(H,34,37)/b28-19+,32-20? |
| InChIKey | BMAJEVFWGDPFGZ-SPGXISLCSA-N |
| XLogP | 5.98 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|