C24H20BrN3O — CID 3382244
N-[(1-benzyl-2-methylindol-3-yl)methylideneamino]-4-bromobenzamide (PubChem CID 3382244) has the molecular formula C24H20BrN3O and a molecular weight of 446.35 g/mol. Its IUPAC name is N-[(1-benzyl-2-methylindol-3-yl)methylideneamino]-4-bromobenzamide.
| Compound Name | N-[(1-benzyl-2-methylindol-3-yl)methylideneamino]-4-bromobenzamide |
|---|---|
| PubChem CID | 3382244 |
| Molecular Formula | C24H20BrN3O |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[(1-benzyl-2-methylindol-3-yl)methylideneamino]-4-bromobenzamide |
| SMILES | Cc1c(C=NNC(=O)c2ccc(Br)cc2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H20BrN3O/c1-17-22(15-26-27-24(29)19-11-13-20(25)14-12-19)21-9-5-6-10-23(21)28(17)16-18-7-3-2-4-8-18/h2-15H,16H2,1H3,(H,27,29) |
| InChIKey | CXWXWJXCDKZYAL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|