C24H19BrIN3O — CID 17245541
2-bromo-N-[(E)-[1-[(4-iodophenyl)methyl]-2-methylindol-3-yl]methylideneamino]benzamide (PubChem CID 17245541) has the molecular formula C24H19BrIN3O and a molecular weight of 572.24 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[1-[(4-iodophenyl)methyl]-2-methylindol-3-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[1-[(4-iodophenyl)methyl]-2-methylindol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245541 |
| Molecular Formula | C24H19BrIN3O |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 570.98 |
| IUPAC Name | 2-bromo-N-[(E)-[1-[(4-iodophenyl)methyl]-2-methylindol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1c(/C=N/NC(=O)c2ccccc2Br)c2ccccc2n1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C24H19BrIN3O/c1-16-21(14-27-28-24(30)20-7-2-4-8-22(20)25)19-6-3-5-9-23(19)29(16)15-17-10-12-18(26)13-11-17/h2-14H,15H2,1H3,(H,28,30)/b27-14+ |
| InChIKey | WTCVTJQHTFQQRF-MZJWZYIUSA-N |
| XLogP | 6.13 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|