C19H18BrN3O — CID 17245319
2-bromo-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide (PubChem CID 17245319) has the molecular formula C19H18BrN3O and a molecular weight of 384.28 g/mol. Its IUPAC name is 2-bromo-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245319 |
| Molecular Formula | C19H18BrN3O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-bromo-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide |
| SMILES | CCn1c(C)c(/C=N/NC(=O)c2ccccc2Br)c2ccccc21 |
| InChI | InChI=1S/C19H18BrN3O/c1-3-23-13(2)16(14-8-5-7-11-18(14)23)12-21-22-19(24)15-9-4-6-10-17(15)20/h4-12H,3H2,1-2H3,(H,22,24)/b21-12+ |
| InChIKey | SIVFUUGGBQRBQO-CIAFOILYSA-N |
| XLogP | 4.50 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|