C19H21N5O3 — CID 110526283
N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 110526283) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 110526283 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CCn1c(C)c(/C=N\NC(=O)Cc2c(C)[nH]c(=O)[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C19H21N5O3/c1-4-24-12(3)15(13-7-5-6-8-16(13)24)10-20-23-17(25)9-14-11(2)21-19(27)22-18(14)26/h5-8,10H,4,9H2,1-3H3,(H,23,25)(H2,21,22,26,27)/b20-10- |
| InChIKey | NHANZJZLRUWFIA-JMIUGGIZSA-N |
| XLogP | 1.35 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|