C19H20N4S — CID 110508605
1-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-3-phenylthiourea (PubChem CID 110508605) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 110508605 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-3-phenylthiourea |
| SMILES | CCn1c(C)c(/C=N/NC(=S)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H20N4S/c1-3-23-14(2)17(16-11-7-8-12-18(16)23)13-20-22-19(24)21-15-9-5-4-6-10-15/h4-13H,3H2,1-2H3,(H2,21,22,24)/b20-13+ |
| InChIKey | ISROWRLMKFGBSY-DEDYPNTBSA-N |
| XLogP | 4.29 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|