C22H26N4O2 — CID 39819226
(2S)-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(2-methoxyanilino)propanamide (PubChem CID 39819226) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2S)-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(2-methoxyanilino)propanamide.
| Compound Name | (2S)-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(2-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 39819226 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2S)-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-(2-methoxyanilino)propanamide |
| SMILES | CCn1c(C)c(/C=N/NC(=O)[C@H](C)Nc2ccccc2OC)c2ccccc21 |
| InChI | InChI=1S/C22H26N4O2/c1-5-26-16(3)18(17-10-6-8-12-20(17)26)14-23-25-22(27)15(2)24-19-11-7-9-13-21(19)28-4/h6-15,24H,5H2,1-4H3,(H,25,27)/b23-14+/t15-/m0/s1 |
| InChIKey | CFSSGTNGGBJOQX-FVQJWRHTSA-N |
| XLogP | 3.93 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|