C24H23N3O — CID 126259376
N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 126259376) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126259376 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | CCn1c(C)c(/C=N\NC(=O)Cc2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O/c1-3-27-17(2)22(21-13-6-7-14-23(21)27)16-25-26-24(28)15-19-11-8-10-18-9-4-5-12-20(18)19/h4-14,16H,3,15H2,1-2H3,(H,26,28)/b25-16- |
| InChIKey | WKQLKPUYXVDUNV-XYGWBWBKSA-N |
| XLogP | 4.82 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|