C22H23N3O2 — CID 21370835
2-(4-methoxyphenyl)-N-[(E)-(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]acetamide (PubChem CID 21370835) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(E)-(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(E)-(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 21370835 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(E)-(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]acetamide |
| SMILES | C=CCn1c(C)c(/C=N/NC(=O)Cc2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O2/c1-4-13-25-16(2)20(19-7-5-6-8-21(19)25)15-23-24-22(26)14-17-9-11-18(27-3)12-10-17/h4-12,15H,1,13-14H2,2-3H3,(H,24,26)/b23-15+ |
| InChIKey | SCLSMQHWYFPIMD-HZHRSRAPSA-N |
| XLogP | 3.84 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|