C27H25Cl2N3O — CID 126366917
N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 126366917) has the molecular formula C27H25Cl2N3O and a molecular weight of 478.42 g/mol. Its IUPAC name is N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126366917 |
| Molecular Formula | C27H25Cl2N3O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(CC(=O)N/N=C\c2c(C)n(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H25Cl2N3O/c1-3-19-8-10-20(11-9-19)15-27(33)31-30-16-23-18(2)32(26-7-5-4-6-22(23)26)17-21-12-13-24(28)25(29)14-21/h4-14,16H,3,15,17H2,1-2H3,(H,31,33)/b30-16- |
| InChIKey | FDYXNWYDVSPRES-UHBFCERESA-N |
| XLogP | 6.56 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|