C25H20Cl2N4O3 — CID 3388547
N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 3388547) has the molecular formula C25H20Cl2N4O3 and a molecular weight of 495.37 g/mol. Its IUPAC name is N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3388547 |
| Molecular Formula | C25H20Cl2N4O3 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1c(C=NNC(=O)Cc2ccc([N+](=O)[O-])cc2)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H20Cl2N4O3/c1-16-21(14-28-29-25(32)13-17-6-9-19(10-7-17)31(33)34)20-4-2-3-5-24(20)30(16)15-18-8-11-22(26)23(27)12-18/h2-12,14H,13,15H2,1H3,(H,29,32) |
| InChIKey | SDUAOOPDNZUQBG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|