C26H18Cl2N4O3S — CID 126389503
N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126389503) has the molecular formula C26H18Cl2N4O3S and a molecular weight of 537.43 g/mol. Its IUPAC name is N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126389503 |
| Molecular Formula | C26H18Cl2N4O3S |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H18Cl2N4O3S/c1-15-21(13-29-30-26(33)25-11-17-10-19(32(34)35)8-9-24(17)36-25)20-4-2-3-5-23(20)31(15)14-16-6-7-18(27)12-22(16)28/h2-13H,14H2,1H3,(H,30,33)/b29-13- |
| InChIKey | GVAZTMLQDDZZNU-DBFSUHOCSA-N |
| XLogP | 7.19 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|