C19H17N3O3S — CID 6301152
5-nitro-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6301152) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-nitro-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6301152 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-nitro-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(C)c(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c(C)c1 |
| InChI | InChI=1S/C19H17N3O3S/c1-11-6-12(2)16(13(3)7-11)10-20-21-19(23)18-9-14-8-15(22(24)25)4-5-17(14)26-18/h4-10H,1-3H3,(H,21,23)/b20-10- |
| InChIKey | CDIRZTHIHOYMTO-JMIUGGIZSA-N |
| XLogP | 4.50 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|