C18H13N3O5S — CID 6068355
N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 6068355) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6068355 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)c1cc3cc([N+](=O)[O-])ccc3s1)OCO2 |
| InChI | InChI=1S/C18H13N3O5S/c1-10-4-14-15(26-9-25-14)6-12(10)8-19-20-18(22)17-7-11-5-13(21(23)24)2-3-16(11)27-17/h2-8H,9H2,1H3,(H,20,22)/b19-8- |
| InChIKey | JEVPLJWVCPUDIJ-UWVJOHFNSA-N |
| XLogP | 3.61 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|