C20H17N5O6S — CID 124551746
N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 124551746) has the molecular formula C20H17N5O6S and a molecular weight of 455.45 g/mol. Its IUPAC name is N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 124551746 |
| Molecular Formula | C20H17N5O6S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1N1CCOCC1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C20H17N5O6S/c26-20(19-11-13-9-16(25(29)30)2-4-18(13)32-19)22-21-12-14-10-15(24(27)28)1-3-17(14)23-5-7-31-8-6-23/h1-4,9-12H,5-8H2,(H,22,26)/b21-12+ |
| InChIKey | DWNSIJUIPMFCAM-CIAFOILYSA-N |
| XLogP | 3.32 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|