C24H20N4O3S — CID 4043106
5-nitro-N-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 4043106) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 5-nitro-N-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4043106 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-nitro-N-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(N2CCCC2)c2ccccc12)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C24H20N4O3S/c29-24(23-14-17-13-18(28(30)31)8-10-22(17)32-23)26-25-15-16-7-9-21(27-11-3-4-12-27)20-6-2-1-5-19(16)20/h1-2,5-10,13-15H,3-4,11-12H2,(H,26,29) |
| InChIKey | UIHGCGNFMNAVBI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|