C21H16N4O5S — CID 3334628
methyl 2-[3-[[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]indol-1-yl]acetate (PubChem CID 3334628) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is methyl 2-[3-[[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 3334628 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | methyl 2-[3-[[(5-nitro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c2ccccc21 |
| InChI | InChI=1S/C21H16N4O5S/c1-30-20(26)12-24-11-14(16-4-2-3-5-17(16)24)10-22-23-21(27)19-9-13-8-15(25(28)29)6-7-18(13)31-19/h2-11H,12H2,1H3,(H,23,27) |
| InChIKey | DVTZGYRDIRIGQJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|