C18H14ClN3O4S — CID 124549181
N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 124549181) has the molecular formula C18H14ClN3O4S and a molecular weight of 403.85 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 124549181 |
| Molecular Formula | C18H14ClN3O4S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1/C=N/NC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C18H14ClN3O4S/c1-2-26-15-5-3-13(19)7-12(15)10-20-21-18(23)17-9-11-8-14(22(24)25)4-6-16(11)27-17/h3-10H,2H2,1H3,(H,21,23)/b20-10+ |
| InChIKey | BVLSSSTVVVCCKD-KEBDBYFISA-N |
| XLogP | 4.63 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|